CymitQuimica logo

CAS 55758-32-2

:

2-Fluoro-5-hydroxypyridine

Description:
2-Fluoro-5-hydroxypyridine is an organic compound characterized by a pyridine ring substituted with a fluorine atom at the second position and a hydroxyl group at the fifth position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits polar characteristics due to the presence of the hydroxyl group, which can engage in hydrogen bonding, influencing its solubility in water and organic solvents. The fluorine atom contributes to the compound's reactivity and can affect its electronic properties, making it useful in various chemical syntheses and applications. 2-Fluoro-5-hydroxypyridine may serve as an intermediate in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals. Its unique structure allows for potential interactions in biological systems, which can be explored for medicinal chemistry applications. As with many fluorinated compounds, it is essential to handle it with care, considering its potential environmental and health impacts.
Formula:C5H4FNO
InChI:InChI=1/C5H4FNO/c6-5-2-1-4(8)3-7-5/h1-3,8H
InChI key:HTRLNWYWOKWCLV-UHFFFAOYSA-N
SMILES:c1cc(F)ncc1O
Synonyms:
  • 6-Fluoro-3-hydroxypyridine
  • 6-Fluoropyridin-3-Ol
Found 5 products.