CAS 5577-42-4

N-(2-methylphenyl)morpholine-4-carboxamide

Description:

N-(2-methylphenyl)morpholine-4-carboxamide, with the CAS number 5577-42-4, is a chemical compound characterized by its morpholine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a carboxamide functional group, indicating the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N). The presence of the 2-methylphenyl group suggests that there is a methyl substituent on the phenyl ring, which can influence the compound's solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The morpholine moiety often contributes to the compound's ability to interact with biological targets, potentially affecting its pharmacokinetics and pharmacodynamics. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, N-(2-methylphenyl)morpholine-4-carboxamide is a versatile compound with potential applications in medicinal chemistry.

Formula: C₁₂H₁₆N₂O₂

InChI: InChI=1/C12H16N2O2/c1-10-4-2-3-5-11(10)13-12(15)14-6-8-16-9-7-14/h2-5H,6-9H2,1H3,(H,13,15)

SMILES: Cc1ccccc1N=C(N1CCOCC1)O

Synonyms:

• 4-morpholinecarboxamide, N-(2-methylphenyl)-
• N-(2-Methylphenyl)morpholine-4-carboxamide

N-[4-(2-Bromoacetyl)phenyl]methanesulfonamide

CAS: 5577-42-4

N-[4-(2-Bromoacetyl)phenyl]methanesulfonamide is a chiral biocatalytic agent, which is synthesized by chemoenzymatic or enzymatic reactions. It has been used in enantioselective synthesis of 4-aminoacetophenone and as an antiarrhythmic agent. This compound is not active against bacterial infections.

Formula: C₉H₁₀BrNO₃S

Purity: Min. 95%

Molecular weight: 292.15 g/mol

Ref: 3D-FB19192