CAS 5579-93-1
:Iopydone
Description:
Iopydone, with the CAS number 5579-93-1, is a chemical compound primarily used as a radiopaque agent in medical imaging, particularly in gastrointestinal studies. It is characterized by its ability to absorb X-rays, which enhances the contrast of images obtained during diagnostic procedures. Iopydone is typically a white to off-white powder that is soluble in water, making it suitable for oral or intravenous administration. Its molecular structure includes iodine, which is responsible for its radiopacity. The compound is generally well-tolerated, but like many iodinated contrast agents, it may cause allergic reactions in some individuals. Additionally, it is important to consider its pharmacokinetics, as it is excreted primarily through the kidneys. Safety and efficacy profiles are well-documented, and it is essential to follow guidelines for its use to minimize potential side effects. Overall, Iopydone plays a crucial role in enhancing the quality of diagnostic imaging in clinical settings.
Formula:C5H3I2NO
InChI:InChI=1S/C5H3I2NO/c6-3-1-8-2-4(7)5(3)9/h1-2H,(H,8,9)
InChI key:InChIKey=FRPFEVLOFNAKBS-UHFFFAOYSA-N
SMILES:O=C1C(I)=CNC=C1I
Synonyms:- 3,5-Diiodo-4(1H)-pyridone
- Iopydone
- 4(1H)-Pyridinone, 3,5-diiodo-
- 4(1H)-Pyridone, 3,5-diiodo-
- 3,5-Diiodo-4(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
