CAS 55791-88-3

N-(3-hydroxyphenyl)-2-methylpropanamide

Description:

N-(3-hydroxyphenyl)-2-methylpropanamide, also known by its CAS number 55791-88-3, is an organic compound characterized by its amide functional group and a substituted aromatic ring. This compound features a 3-hydroxyphenyl group, which contributes to its potential for hydrogen bonding and solubility in polar solvents. The presence of the 2-methylpropanamide structure indicates that it has a branched alkyl chain, which can influence its physical properties, such as melting and boiling points. Typically, compounds like this may exhibit moderate to high polarity due to the hydroxyl group, making them soluble in water and other polar solvents. Additionally, the compound may possess biological activity, as many amides and phenolic compounds are known for their roles in pharmaceuticals and biochemistry. Its specific reactivity and interactions would depend on the surrounding environment and the presence of other functional groups. Overall, N-(3-hydroxyphenyl)-2-methylpropanamide is a compound of interest in both synthetic chemistry and potential medicinal applications.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1/C10H13NO2/c1-7(2)10(13)11-8-4-3-5-9(12)6-8/h3-7,12H,1-2H3,(H,11,13)

SMILES: CC(C)C(=Nc1cccc(c1)O)O

N-(3-Hydroxyphenyl)-2-methylpropanamide

CAS: 55791-88-3

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₂

Purity: Min. 95%

Molecular weight: 179.22 g/mol

Ref: 3D-FCA79188