CAS 55805-21-5

4-(Difluoromethyl)benzoic acid

Description:

4-(Difluoromethyl)benzoic acid, with the CAS number 55805-21-5, is an aromatic carboxylic acid characterized by the presence of a benzoic acid moiety substituted with a difluoromethyl group at the para position. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic ring. The difluoromethyl group introduces unique electronic and steric properties, which can influence the compound's reactivity and interactions in chemical reactions. As a carboxylic acid, it possesses acidic properties, allowing it to participate in acid-base reactions. The presence of fluorine atoms can enhance the compound's stability and lipophilicity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific biological activities, which can be explored for potential applications in drug development or as a building block in organic synthesis.

Formula: C₈H₆F₂O₂

InChI: InChI=1S/C8H6F2O2/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4,7H,(H,11,12)

InChI key: InChIKey=AVYXJQFZBUXNHB-UHFFFAOYSA-N

SMILES: C(F)(F)C1=CC=C(C(O)=O)C=C1

Synonyms:

• Benzoic acid, 4-(difluoromethyl)-
• α,α-Difluoro-p-toluic acid
• 4-(Difluoromethyl)benzoic acid

4-(Difluoromethyl)benzoic acid

CAS: 55805-21-5

Formula: C₈H₆F₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.1288

Ref: IN-DA00DD8B

4-(Difluoromethyl)benzoic acid

CAS: 55805-21-5

4-(Difluoromethyl)benzoic acid

Formula: C₈H₆F₂O₂

Purity: 95%

Color and Shape: faint yellow/green powder

Molecular weight: 172.13g/mol

Ref: 54-PC1019

Fluralaner Impurity 27

CAS: 55805-21-5

Formula: C₈H₆F₂O₂

Molecular weight: 172.13

Ref: 4Z-F-179037

4-(Difluoromethyl)benzoic acid

CAS: 55805-21-5

Formula: C₈H₆F₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.131

Ref: 10-F035820