CAS 5581-42-0

4-chloro-N-{[4-(dimethylamino)phenyl]carbamoyl}benzenesulfonamide

Description:

4-Chloro-N-{[4-(dimethylamino)phenyl]carbamoyl}benzenesulfonamide, with the CAS number 5581-42-0, is a chemical compound that belongs to the class of sulfonamides. This substance features a sulfonamide functional group, which is characterized by the presence of a sulfonyl group (–SO2) attached to an amine. The compound also contains a chloro substituent and a dimethylamino group, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide and amine functionalities. The presence of the chloro group can influence its reactivity and potential applications in pharmaceuticals or agrochemicals. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as sulfonamides can have specific toxicity profiles. Overall, this compound's structure suggests potential utility in various chemical and biological applications.

Formula: C₁₅H₁₆ClN₃O₃S

InChI: InChI=1/C15H16ClN3O3S/c1-19(2)13-7-5-12(6-8-13)17-15(20)18-23(21,22)14-9-3-11(16)4-10-14/h3-10H,1-2H3,(H2,17,18,20)

SMILES: CN(C)c1ccc(cc1)NC(=NS(=O)(=O)c1ccc(cc1)Cl)O

Synonyms:

• 1-((p-Chlorophenyl)sulfonyl)-3-(p-(dimethylamino)phenyl)urea
• 4-Chloro-N-(((4-(dimethylamino)phenyl)amino)carbonyl)benzenesulfonamide

Glyparamide

CAS: 5581-42-0

Formula: C₁₅H₁₆ClN₃O₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 353.8238

Ref: IN-DA00DB68

Glyparamide

CAS: 5581-42-0

Glyparamide

Purity: ≥98%

Molecular weight: 353.82g/mol

Ref: 54-BUP18879

Glyparamide

CAS: 5581-42-0

Glyparamide is a chlorophenyl-containing sulfonylurea with hypoglycemic activity.

Formula: C₁₅H₁₆ClN₃O₃S

Purity: 99.80%

Color and Shape: Solid

Molecular weight: 353.82

Ref: TM-T13712