CAS 5581-55-5
:methyl-D3-amine
Description:
Methyl-D3-amine, also known as deuterated methylamine, is a chemical compound characterized by the presence of deuterium, a stable isotope of hydrogen, in its molecular structure. Its molecular formula is C2H9N, with the deuterium atoms replacing regular hydrogen atoms, which alters its physical and chemical properties slightly compared to its non-deuterated counterpart. Methyl-D3-amine is typically a colorless gas or liquid at room temperature and has a distinct amine odor. It is soluble in water and organic solvents, making it useful in various chemical syntheses and research applications, particularly in studies involving isotopic labeling. The presence of deuterium can enhance the stability of certain compounds and is often utilized in NMR spectroscopy to trace reaction pathways. As with other amines, it can act as a base and may participate in various chemical reactions, including alkylation and acylation. Safety precautions should be observed when handling this compound, as it can be flammable and may cause irritation to the skin and respiratory system.
Formula:CH2D3N
InChI:InChI=1/CH5N/c1-2/h2H2,1H3/i1D3
SMILES:C(N)([2H])([2H])[2H]
Synonyms:- (~2~H_3_)methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl-d3-amine (gaz)
CAS:Formula:CD3NH2Purity:99 atom % DColor and Shape:Colorless GasMolecular weight:34.06103Methylamine-D3
CAS:Controlled Product<p>Applications A dueterated isotope of Methylamine (M285560) a common chemical reagent used in the synthesis of 2-aminoquinolines as potent and selective inhibitors of neuronal nitric oxide synthase for neurodegenrative disorders.<br>References Cinelli, M. et al.: J. Med. Chem., 58, 8694 (2015);<br></p>Formula:CD3H2NColor and Shape:ColourlessMolecular weight:34.0756



