CAS 55817-76-0

2-amino-1-[3-(dimethylamino)propyl]-4,5-dimethyl-1H-pyrrole-3-carbonitrile

Description:

2-amino-1-[3-(dimethylamino)propyl]-4,5-dimethyl-1H-pyrrole-3-carbonitrile, with the CAS number 55817-76-0, is a chemical compound characterized by its complex structure, which includes a pyrrole ring substituted with various functional groups. This compound features an amino group, a carbonitrile group, and a dimethylamino group, contributing to its potential biological activity. The presence of the pyrrole ring suggests that it may exhibit properties typical of heterocyclic compounds, such as the ability to participate in various chemical reactions and interactions. The dimethylamino group can enhance solubility and influence the compound's pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of multiple methyl groups can affect the compound's steric and electronic properties, potentially impacting its reactivity and interactions with biological targets. Overall, this compound may have applications in drug development or as a research tool in various fields of chemistry and biochemistry.

Formula: C₁₂H₂₀N₄

InChI: InChI=1/C12H20N4/c1-9-10(2)16(7-5-6-15(3)4)12(14)11(9)8-13/h5-7,14H2,1-4H3

SMILES: Cc1c(C)n(CCCN(C)C)c(c1C#N)N

Synonyms:

• 1H-pyrrole-3-carbonitrile, 2-amino-1-[3-(dimethylamino)propyl]-4,5-dimethyl-

2-Amino-1-[3-(dimethylamino)propyl]-4,5-dimethyl-1H-pyrrole-3-carbonitrile

CAS: 55817-76-0

Versatile small molecule scaffold

Formula: C₁₂H₂₀N₄

Purity: Min. 95%

Molecular weight: 220.31 g/mol

Ref: 3D-FCA81776