CAS 55819-76-6

N'-acetyl-2-cyanoacetohydrazide

Description:

N'-Acetyl-2-cyanoacetohydrazide, with the CAS number 55819-76-6, is an organic compound characterized by its hydrazide functional group and the presence of both cyano and acetyl groups. This compound typically appears as a crystalline solid and is soluble in polar solvents due to its ability to form hydrogen bonds. It is known for its reactivity, particularly in condensation reactions, which can lead to the formation of various derivatives. The presence of the cyano group contributes to its potential as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, N'-acetyl-2-cyanoacetohydrazide may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with many organic compounds, it may pose health risks if not managed properly. Overall, its unique structure and functional groups make it a valuable compound in synthetic organic chemistry.

Formula: C₅H₇N₃O₂

InChI: InChI=1/C5H7N3O2/c1-4(9)7-8-5(10)2-3-6/h2H2,1H3,(H,7,9)(H,8,10)

SMILES: CC(=NN=C(CC#N)O)O

Synonyms:

• Acetic Acid, 2-Cyano-, 2-Acetylhydrazide

N'1-acetyl-2-cyanoethanohydrazide

CAS: 55819-76-6

N'1-acetyl-2-cyanoethanohydrazide

Purity: ≥95%

Molecular weight: 141.13g/mol

Ref: 54-OR23605