CymitQuimica logo

CAS 55822-82-7

:

benzyl N-[(benzyloxy)carbonyl]-3-chloro-L-alaninate

Description:
Benzyl N-[(benzyloxy)carbonyl]-3-chloro-L-alaninate, with the CAS number 55822-82-7, is a synthetic organic compound that belongs to the class of amino acid derivatives. It features a benzyl group, which contributes to its hydrophobic characteristics, and a chloro substituent on the alanine backbone, which can influence its reactivity and biological activity. The presence of the benzyloxycarbonyl (Z) protecting group indicates that this compound is likely used in peptide synthesis, as it can protect the amino group during chemical reactions. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in organic synthesis. Additionally, the chloro group may impart unique reactivity, making it a candidate for further chemical transformations. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C18H18ClNO4
InChI:InChI=1/C18H18ClNO4/c19-11-16(17(21)23-12-14-7-3-1-4-8-14)20-18(22)24-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,20,22)/t16-/m0/s1
SMILES:c1ccc(cc1)COC(=O)[C@H](CCl)N=C(O)OCc1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.