CAS 55831-56-6

(2Z)-3-chlorobut-2-enoic acid

Description:

(2Z)-3-chlorobut-2-enoic acid, also known as 3-chloro-2-butenoic acid, is an organic compound characterized by its unsaturated carboxylic acid structure. It features a double bond between the second and third carbon atoms, with a chlorine substituent at the third carbon. This compound is typically a colorless to pale yellow liquid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. The Z configuration indicates that the highest priority substituents on the double bond are on the same side, which can influence its reactivity and interactions with other molecules. It is used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals and agrochemicals. As with many chlorinated compounds, it may exhibit biological activity, and safety precautions should be taken when handling it due to potential toxicity. Its reactivity is influenced by the presence of both the double bond and the electronegative chlorine atom, making it a versatile compound in organic synthesis.

Formula: C₄H₅ClO₂

InChI: InChI=1/C4H5ClO2/c1-3(5)2-4(6)7/h2H,1H3,(H,6,7)/b3-2-

SMILES: C/C(=C/C(=O)O)/Cl

Synonyms:

• 2-butenoic acid, 3-chloro-, (2Z)-
• trans-3-Chlorocrotonic acid