CAS 55842-53-0
:2-methyl-1,3-thiazole-4-carbonyl chloride
Description:
2-Methyl-1,3-thiazole-4-carbonyl chloride is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride derivative. It is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of the carbonyl chloride group indicates that it can undergo nucleophilic acyl substitution reactions, making it useful in organic synthesis for the introduction of acyl groups into various substrates. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. Additionally, this compound may exhibit moderate to high reactivity, particularly towards water and alcohols, leading to the formation of corresponding acids or esters. Proper handling and storage are essential due to its potential corrosive nature and reactivity.
Formula:C5H4ClNOS
InChI:InChI=1/C5H4ClNOS/c1-3-7-4(2-9-3)5(6)8/h2H,1H3
SMILES:Cc1nc(cs1)C(=O)Cl
Synonyms:- 2-Methyl-4-thiazolecarbonyl chloride
- 55842-53-0
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery