CAS 5585-62-6
:N,N'-[ethane-1,2-diylbis(oxybenzene-4,1-diylmethanediyl)]bis(N-methylhexan-1-amine) dihydrochloride
Description:
N,N'-[ethane-1,2-diylbis(oxybenzene-4,1-diylmethanediyl)]bis(N-methylhexan-1-amine) dihydrochloride is a complex organic compound characterized by its unique structure, which includes multiple functional groups and a bis(amine) component. This substance features a central ethane-1,2-diyl linkage, connecting two oxybenzene units, which are further substituted with N-methylhexan-1-amine groups. The presence of dihydrochloride indicates that the compound exists as a salt, enhancing its solubility in polar solvents, particularly water. The compound's structure suggests potential applications in fields such as pharmaceuticals or materials science, where its amine functionalities may participate in various chemical reactions or interactions. Additionally, the presence of aromatic rings may contribute to stability and specific electronic properties. Overall, this compound exemplifies the complexity and versatility of organic chemistry, with potential implications in various chemical and industrial applications.
Formula:C30H50Cl2N2O2
InChI:InChI=1/C30H48N2O2.2ClH/c1-5-7-9-11-21-31(3)25-27-13-17-29(18-14-27)33-23-24-34-30-19-15-28(16-20-30)26-32(4)22-12-10-8-6-2;;/h13-20H,5-12,21-26H2,1-4H3;2*1H
Synonyms:- G16726
- 5585-62-6
- Symetine Hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Symetine dihydrochloride
CAS:<p>Symetine dihydrochloride (L 16726 dihydrochloride) is the bis-hydrochloride form of Symetine. It exhibits antiprotozoal activity against Entamoeba histolytica and can ameliorate amoebic liver abscesses in guinea pigs.</p>Formula:C30H50Cl2N2O2Color and Shape:SolidMolecular weight:541.64
