CAS 55860-23-6

3-chloro-N-(2-methoxyphenyl)propanamide

Description:

3-Chloro-N-(2-methoxyphenyl)propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the third carbon position and a methoxy-substituted phenyl group at the nitrogen atom contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents due to its polar amide group and non-polar hydrocarbon chain. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with biological activity. The methoxy group can enhance lipophilicity, potentially influencing the compound's interaction with biological membranes. Additionally, the chlorine substituent may affect the compound's reactivity and stability. As with many organic compounds, safety and handling precautions are essential, as the chlorine atom can impart toxicity. Overall, 3-chloro-N-(2-methoxyphenyl)propanamide is a compound of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₀H₁₂ClNO₂

InChI: InChI=1/C10H12ClNO2/c1-14-9-5-3-2-4-8(9)12-10(13)6-7-11/h2-5H,6-7H2,1H3,(H,12,13)

SMILES: COc1ccccc1N=C(CCCl)O

3-Chloro-N-(2-methoxyphenyl)propanamide

CAS: 55860-23-6

Formula: C₁₀H₁₂ClNO₂

Color and Shape: Solid

Molecular weight: 213.6608

Ref: IN-DA00DCOU

3-Chloro-N-(2-methoxyphenyl)propanamide

Controlled Product

CAS: 55860-23-6

Applications 3-Chloro-N-(2-methoxyphenyl)propanamide is an intermediate used in the synthesis of 8-Hydroxy-3,4-dihydro-2(1H)-quinolinone (H941405), which is used in the studies of salvianolic acid B metabolites. Aripiprazole Impurity 5.
References Yuan, Z., et al.: Zhongguo Ziandai Zhongyao, 10, 29 (2008)

Formula: C₁₀H₁₂ClNO₂

Color and Shape: Neat

Molecular weight: 213.661

Ref: TR-C374210