CAS 55864-87-4

Ethyl 4-nitro-1H-pyrazole-5-carboxylate

Description:

Ethyl 4-nitro-1H-pyrazole-5-carboxylate is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a nitro group (-NO2) at the 4-position and an ethyl ester group at the 5-position contributes to its chemical reactivity and potential applications. This compound typically appears as a yellow to orange crystalline solid and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water. Ethyl 4-nitro-1H-pyrazole-5-carboxylate is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to undergo various chemical transformations. Its nitro group can participate in reduction reactions, while the carboxylate moiety can engage in esterification or amidation reactions. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental hazards.

Formula: C₆H₇N₃O₄

InChI: InChI=1/C6H7N3O4/c1-2-13-6(10)5-4(9(11)12)3-7-8-5/h3H,2H2,1H3,(H,7,8)

SMILES: CCOC(=O)c1c(c[nH]n1)N(=O)=O

Synonyms:

• 1H-Pyrazole-5-carboxylic acid, 4-nitro-, ethyl ester
• Ethyl4-nitro-1H-pyrazole-5-carboxylate

Nsc360636

CAS: 55864-87-4

Formula: C₆H₇N₃O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 185.1375

Ref: IN-DA00DFRF

Ethyl 4-Nitro-1H-Pyrazole-3-Carboxylate

CAS: 55864-87-4

Ethyl 4-Nitro-1H-Pyrazole-3-Carboxylate

Purity: 95%

Molecular weight: 185.14g/mol

Ref: 54-OR1013210

Ethyl 4-nitro-1H-pyrazole-5-carboxylate

CAS: 55864-87-4

Formula: C₆H₇N₃O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 185.139

Ref: 10-F093119