CAS 55873-09-1
:2-chloropyrimidin-4(3H)-one
Description:
2-Chloropyrimidin-4(3H)-one, with the CAS number 55873-09-1, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom and a keto group. This compound features a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions, which contributes to its basicity and reactivity. The presence of the chlorine atom at the 2-position enhances its electrophilic character, making it a useful intermediate in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The keto group at the 4-position plays a crucial role in its reactivity, allowing for potential tautomerization and participation in nucleophilic addition reactions. 2-Chloropyrimidin-4(3H)-one is typically a solid at room temperature and is soluble in polar organic solvents. Its unique structure and functional groups make it a valuable compound in medicinal chemistry, where it can serve as a scaffold for the design of biologically active molecules.
Formula:C4H3ClN2O
InChI:InChI=1/C4H3ClN2O/c5-4-6-2-1-3(8)7-4/h1-2H,(H,6,7,8)
Synonyms:- 2-chloropyrimidin-4(1H)-one
- 2-Chlorpyrimidin-4(1H)-on
- 4-Pyrimidinol, 2-Chloro-
- 2-Chloro-4-hydroxypyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Chloro-4(3H)-pyrimidinone
CAS:Formula:C4H3ClN2OPurity:95%Color and Shape:SolidMolecular weight:130.5324Ref: IN-DA0039R8
1g55.00€5g121.00€10g172.00€25g501.00€50gTo inquire100gTo inquire250gTo inquire100mg20.00€250mg28.00€Pazopanib Impurity 24
CAS:Formula:C4H3ClN2OColor and Shape:White To Off-White SolidMolecular weight:130.532-Chloro-4-hydroxypyrimidine
CAS:2-Chloro-4-hydroxypyrimidine is a reactive heterocycle that belongs to the group of quinazolines. It can be synthesized by reacting pyrimidine with thiophosgene and thiol in an analogous reaction, or through the substitution of amino acids with isothiocyanate. Analogues of this compound exist that have been shown to be chemoselective for the replacement of 2-chloro-4-hydroxypyrimidine residues in proteins.Formula:C4H3ClN2OPurity:Min. 95%Color and Shape:White PowderMolecular weight:130.53 g/mol2-Chloro-4(1H)-pyrimidinone Hydrochloride
CAS:Controlled ProductApplications 2-Chloro-4(1H)-pyrimidinone Hydrochloride is a reactant in the preparation of aminobenzamide derivatives as glycogen synthase kinase 3β (GSK3β) inhibitors for preventing or treating GSK3β-mediated diseases (1).
References (1) Freyne, E.J.E., et al.: PCT Int. Appl., WO 2003037877 (2003Formula:C4H3ClN2O•HClColor and Shape:NeatMolecular weight:166.99






