CAS 55875-55-3

4-(2-aminopropyl)-N,N-dimethylaniline dihydrochloride

Description:

4-(2-Aminopropyl)-N,N-dimethylaniline dihydrochloride, with the CAS number 55875-55-3, is a chemical compound that belongs to the class of substituted anilines. It is characterized by the presence of an amino group and two methyl groups attached to a phenyl ring, which contributes to its basicity and potential reactivity. The dihydrochloride form indicates that the compound is a salt, typically enhancing its solubility in water and making it more stable for storage and handling. This compound may exhibit properties such as being a colorless to light yellow solid, with a characteristic amine odor. It is often used in various applications, including as an intermediate in organic synthesis and potentially in the production of dyes or pharmaceuticals. Safety precautions should be taken when handling this substance, as it may pose health risks such as skin or respiratory irritation. Proper storage in a cool, dry place away from incompatible substances is recommended to maintain its stability and efficacy.

Formula: C₁₁H₂₀Cl₂N₂

InChI: InChI=1/C11H18N2.2ClH/c1-9(12)8-10-4-6-11(7-5-10)13(2)3;;/h4-7,9H,8,12H2,1-3H3;2*1H

SMILES: CC(Cc1ccc(cc1)N(C)C)N.Cl.Cl

4-(2-Aminopropyl)-N,N-dimethylaniline dihydrochloride

Controlled Product

CAS: 55875-55-3

Versatile small molecule scaffold

Formula: C₁₁H₂₀Cl₂N₂

Purity: Min. 95%

Molecular weight: 251.19 g/mol

Ref: 3D-FCA87555