CAS 55876-91-0

methyl 5-formylpyridine-2-carboxylate

Description:

Methyl 5-formylpyridine-2-carboxylate, with the CAS number 55876-91-0, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a formyl group (-CHO) and a carboxylate group (-COOCH3) attached to the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both the aldehyde and ester functional groups allows for various chemical reactions, including nucleophilic additions and condensation reactions. Methyl 5-formylpyridine-2-carboxylate can be utilized in the synthesis of more complex molecules, making it valuable in medicinal chemistry and material science. Additionally, its properties may include moderate solubility in organic solvents and stability under standard laboratory conditions, although specific handling precautions should be observed due to potential reactivity.

Formula: C₈H₇NO₃

InChI: InChI=1/C8H7NO3/c1-12-8(11)7-3-2-6(5-10)4-9-7/h2-5H,1H3

SMILES: COC(=O)c1ccc(cn1)C=O

Synonyms:

• 2-Pyridinecarboxylic Acid, 5-Formyl-, Methyl Ester
• Methyl 5-Formylpicolinate

Methyl 5-formylpicolinate

CAS: 55876-91-0

Formula: C₈H₇NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 165.1461

Ref: IN-DA00DKWE

methyl 5-formylpyridine-2-carboxylate

CAS: 55876-91-0

methyl 5-formylpyridine-2-carboxylate

Purity: 99%

Molecular weight: 165.15g/mol

Ref: 54-OR959539

METHYL 5-FORMYLPICOLINATE

CAS: 55876-91-0

Formula: C₈H₇NO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 165.148

Ref: 10-F304701