CAS 55879-48-6
:(11β,16α)-9-Fluoro-11,17,20,21-tetrahydroxy-16-methylpregna-1,4-dien-3-one
Description:
The chemical substance known as "(11β,16α)-9-Fluoro-11,17,20,21-tetrahydroxy-16-methylpregna-1,4-dien-3-one," with the CAS number 55879-48-6, is a synthetic corticosteroid. It is characterized by its complex steroid structure, which includes multiple hydroxyl groups that contribute to its biological activity. The presence of a fluorine atom at the 9-position enhances its potency and anti-inflammatory properties. This compound exhibits glucocorticoid activity, making it effective in modulating immune responses and inflammation. Its structural modifications, such as the methyl group at the 16-position and the specific arrangement of hydroxyl groups, influence its pharmacokinetics and receptor binding affinity. As a corticosteroid, it is utilized in various therapeutic applications, including the treatment of inflammatory and autoimmune conditions. However, like other corticosteroids, it may have side effects, including potential impacts on metabolism and immune function. Overall, this compound represents a significant advancement in steroid chemistry, providing enhanced therapeutic benefits in clinical settings.
Formula:C22H31FO5
InChI:InChI=1S/C22H31FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-18,24,26-28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,17+,18?,19+,20+,21+,22+/m1/s1
InChI key:InChIKey=YEIWLFZTBMWOCO-OHPOEQDUSA-N
SMILES:F[C@@]12[C@]([C@]3([C@](C)(C[C@@H]1O)[C@](C(CO)O)(O)[C@H](C)C3)[H])(CCC=4[C@]2(C)C=CC(=O)C4)[H]
Synonyms:- Pregna-1,4-dien-3-one, 9-fluoro-11,17,20,21-tetrahydroxy-16-methyl-, (11β,16α)-
- (11β,16α)-9-Fluoro-11,17,20,21-tetrahydroxy-16-methylpregna-1,4-dien-3-one
- 20-Dihydrodexamethasone
- 20-Hydroxydexamethasone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
20-Hydroxydexamethasone
CAS:Controlled ProductFormula:C22H31FO5Color and Shape:NeatMolecular weight:394.48

