CymitQuimica logo

CAS 5588-11-4

:

N-(2,5-dimethyl-1H-pyrrol-1-yl)pyridine-4-carboxamide

Description:
N-(2,5-dimethyl-1H-pyrrol-1-yl)pyridine-4-carboxamide, with the CAS number 5588-11-4, is a chemical compound characterized by its unique structure, which includes a pyridine ring and a pyrrole moiety. This compound typically exhibits properties associated with both heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the carboxamide functional group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the dimethyl substitution on the pyrrole ring can affect its electronic properties and steric hindrance, potentially impacting its interaction with biological targets. Compounds of this nature are often studied for their pharmacological properties, including antimicrobial or anti-inflammatory activities. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is analyzed. Overall, this compound represents a class of organic molecules that may have significant applications in medicinal chemistry and drug development.
Formula:C12H13N3O
InChI:InChI=1/C12H13N3O/c1-9-3-4-10(2)15(9)14-12(16)11-5-7-13-8-6-11/h3-8H,1-2H3,(H,14,16)
SMILES:Cc1ccc(C)n1NC(=O)c1ccncc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.