CAS 5589-41-3

4,27-dihydroxy-5,6:22,26-diepoxyergost-24-ene-1,26-dione

Description:

4,27-Dihydroxy-5,6:22,26-diepoxyergost-24-ene-1,26-dione, with the CAS number 5589-41-3, is a complex organic compound belonging to the class of sterols. This substance features multiple hydroxyl groups and epoxy functionalities, which contribute to its reactivity and biological activity. The presence of the ergostane skeleton indicates that it is structurally related to ergosterol, a key sterol found in fungal cell membranes. The compound's hydroxyl groups can participate in hydrogen bonding, influencing its solubility and interaction with biological systems. The epoxy groups may also play a role in its reactivity, potentially allowing for further chemical transformations. This compound is of interest in various fields, including biochemistry and pharmacology, due to its potential effects on cell membranes and its role in biological processes. Its unique structure may also suggest potential applications in medicinal chemistry, particularly in the development of antifungal agents or other therapeutic compounds. However, specific biological activities and applications would require further investigation and research.

Formula: C₂₈H₄₀O₆

InChI: InChI=1/C28H40O6/c1-14-11-21(33-25(32)17(14)13-29)15(2)18-5-6-19-16-12-24-28(34-24)23(31)8-7-22(30)27(28,4)20(16)9-10-26(18,19)3/h15-16,18-21,23-24,29,31H,5-13H2,1-4H3

SMILES: CC1=C(CO)C(=O)OC(C1)C(C)C1CCC2C3CC4C5(C(CCC(=O)C5(C)C3CCC12C)O)O4

Dihydrowithaferin A

CAS: 5589-41-3

Dihydrowithaferin A

Purity: ≥98%

Molecular weight: 472.61g/mol

Ref: 54-BUP00220

Dihydrowithaferin A

CAS: 5589-41-3

Dihydrowithaferin A, a withanolide from Withania somnifera, inhibits AChE and may reduce tumor growth.

Formula: C₂₈H₄₀O₆

Purity: 99.85%

Color and Shape: Solid

Molecular weight: 472.61

Ref: TM-TN1589

Dihydrowithaferin A

CAS: 5589-41-3

Formula: C₂₈H₄₀O₆

Molecular weight: 472.62

Ref: 7W-GY1369

Dihydrowithaferin A

CAS: 5589-41-3

Formula: C₂₈H₄₀O₆

Purity: 95%~99%

Molecular weight: 472.622

Ref: BP-BP4187

2,3-Dihydrowithaferin A

CAS: 5589-41-3

Formula: C₂₈H₄₀O₆

Molecular weight: 472.62

Ref: 4Z-W-011002

Dihydrowithaferin A

CAS: 5589-41-3

Dihydrowithaferin A is a steroidal lactone, which is a naturally occurring compound extracted from the plant *Withania somnifera*, commonly known as Ashwagandha. This bioactive molecule is primarily sourced from the roots and leaves of the plant. Its mode of action involves the inhibition of specific cellular pathways, such as nuclear factor kappa-light-chain-enhancer of activated B cells (NF-kB) signaling. It also exhibits the ability to modulate oxidative stress and induce apoptosis in cancerous cells.

Formula: C₂₈H₄₀O₆

Purity: Min. 95%

Molecular weight: 472.6 g/mol

Ref: 3D-FAA58941