CAS 5589-62-8

2-[(Phenylmethyl)amino]benzonitrile

Description:

2-[(Phenylmethyl)amino]benzonitrile, also known by its CAS number 5589-62-8, is an organic compound characterized by the presence of both an amino group and a nitrile group attached to a benzene ring. This compound features a phenylmethyl (benzyl) group linked to the amino nitrogen, which contributes to its structural complexity and potential reactivity. It typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the aromatic rings. The presence of the nitrile group (-C≡N) imparts notable chemical properties, including the ability to participate in nucleophilic reactions and serve as a precursor for various synthetic pathways. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its stability and reactivity can be influenced by the electronic effects of the substituents on the aromatic rings, which can affect its interactions in biological systems or chemical reactions.

Formula: C₁₄H₁₂N₂

InChI: InChI=1S/C14H12N2/c15-10-13-8-4-5-9-14(13)16-11-12-6-2-1-3-7-12/h1-9,16H,11H2

InChI key: InChIKey=JNNJQGFCEMZAQR-UHFFFAOYSA-N

SMILES: N(CC1=CC=CC=C1)C2=C(C#N)C=CC=C2

Synonyms:

• N-Benzyl-2-aminobenzonitrile
• Anthranilonitrile, N-benzyl-
• N-Benzylanthranilonitrile
• Benzonitrile, 2-[(phenylmethyl)amino]-
• 2-[(Phenylmethyl)amino]benzonitrile

2-(Benzylamino)benzonitrile

CAS: 5589-62-8

Formula: C₁₄H₁₂N₂

Molecular weight: 208.2585

Ref: IN-DA00DKKY

2-(Benzylamino)benzonitrile

CAS: 5589-62-8

2-(Benzylamino)benzonitrile is an organometallic reagent that is used in the synthesis of heterocyclic compounds. It can be used to form anions with various halides, such as 2-aminobenzaldehyde and quinazolines. The chemical rearrangements of acyl halides are a common reaction that occurs when 2-(benzylamino)benzonitrile is exposed to acid or base. This reaction produces 6-membered heterocycles, which have been shown to have therapeutic potential against cancer cells.

Formula: C₁₄H₁₂N₂

Purity: Min. 95%

Molecular weight: 208.26 g/mol

Ref: 3D-FAA58962