CAS 559-70-6: β-Amyrin
Description:β-Amyrin is a triterpenoid compound classified as a pentacyclic triterpene, commonly found in various plants, particularly in the family of Euphorbiaceae and in some medicinal herbs. It has a molecular formula of C30H50O and a molecular weight of approximately 426.7 g/mol. β-Amyrin is characterized by its white crystalline appearance and is known for its significant biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties. The compound exhibits a complex structure with multiple rings, contributing to its stability and interaction with biological systems. It is often studied for its potential therapeutic applications, particularly in traditional medicine. Additionally, β-Amyrin can be involved in the biosynthesis of other important compounds and is recognized for its role in plant defense mechanisms. Its solubility is generally low in water but can dissolve in organic solvents, making it suitable for various extraction methods in phytochemistry. Overall, β-Amyrin is a compound of interest in both natural product chemistry and pharmacology.
Formula:C30H50O
InChI:InChI=1S/C30H50O/c1-25(2)15-16-27(5)17-18-29(7)20(21(27)19-25)9-10-23-28(6)13-12-24(31)26(3,4)22(28)11-14-30(23,29)8/h9,21-24,31H,10-19H2,1-8H3/t21-,22-,23+,24-,27+,28-,29+,30+/m0/s1
InChI key:InChIKey=JFSHUTJDVKUMTJ-QHPUVITPSA-N
SMILES:OC1CCC2(C)C(CCC3(C)C2CC=C4C5CC(C)(C)CCC5(C)CCC43C)C1(C)C
- Synonyms:
- (+)-β-Amyrin
- (3Beta,5Xi,9Xi)-Olean-12-En-3-Ol
- (3Beta,5Xi,9Xi,18Xi)-Olean-12-En-3-Ol
- (3S,4aR,6aR,6bS,8aR,12aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-Octamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydro-3-picenol
- (3beta)-Olean-12-en-3-ol
- (3β)-Olean-12-en-3-ol
- .beta.-Amyrenol
- .beta.-Amyrin
- 3β-Hydroxyolean-12-ene
- 559-70-6
- See more synonyms
- Nsc 527971
- Olean-12-En-3-Ol
- Olean-12-en-3-ol, (3β)-
- Oleane-12-Ene-3Β-Ol
- β-Amirin
- β-Amyrenol
- β-Amyrine
- Olean-12-en-3β-ol
