CAS 5590-14-7
:(1R,2R)-2-phenylcyclopropanecarbonitrile
Description:
(1R,2R)-2-phenylcyclopropanecarbonitrile, with the CAS number 5590-14-7, is a chiral organic compound characterized by its cyclopropane structure substituted with a phenyl group and a cyano group. This compound features a three-membered cyclopropane ring, which contributes to its unique reactivity and strain characteristics. The presence of the cyano group (-C≡N) imparts notable polarity and can participate in various chemical reactions, including nucleophilic additions and electrophilic substitutions. The phenyl group enhances the compound's aromatic properties and can influence its solubility and interaction with other molecules. As a chiral molecule, it exists in two enantiomeric forms, with the (1R,2R) configuration being one of them, which can exhibit different biological activities and reactivities compared to its counterpart. This compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals due to its structural features. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and solvent used.
Formula:C10H9N
InChI:InChI=1/C10H9N/c11-7-9-6-10(9)8-4-2-1-3-5-8/h1-5,9-10H,6H2/t9-,10-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
rac-(1R,2R)-2-Phenylcyclopropane-1-carbonitrile
CAS:Rac-1R,2R-2-phenylcyclopropane-1-carbonitrile is an enantiopure compound with two chiral centers. It is a reaction intermediate in the synthesis of prodrugs for the treatment of cancer. Rac-1R,2R-2-phenylcyclopropane-1-carbonitrile is converted to its corresponding amide by reaction with ammonia and then reacted with hydrochloric acid to form the corresponding ester. The optical purity of rac-(1R,2R)-2-phenylcyclopropane-1-carbonitrile can be determined by measuring the optical rotation of the chiral center at 366 nm. Rac-(1R,2R)-2-phenylcyclopropane-1-carbonitrile has a spontaneous rate constant of k=0.02±0.001 s−1 and an additivity parameter of ΔH=-3.84±0.17 kcal mol−1Formula:C10H9NPurity:Min. 95%Molecular weight:143.18 g/mol
