CAS 55901-61-6
:5-Methyl-1-phenyl-1,4-hexadien-3-one
Description:
5-Methyl-1-phenyl-1,4-hexadien-3-one, with the CAS number 55901-61-6, is an organic compound characterized by its conjugated diene structure, which contributes to its reactivity and potential applications in organic synthesis. This compound features a phenyl group attached to a hexadiene backbone, along with a ketone functional group, which influences its chemical properties, such as polarity and reactivity. The presence of the methyl group at the 5-position adds to its steric and electronic characteristics, potentially affecting its stability and interaction with other molecules. This compound may exhibit interesting optical properties due to its conjugated system, making it of interest in fields such as materials science and organic electronics. Additionally, its structural features suggest potential applications in the synthesis of more complex organic molecules or as an intermediate in various chemical reactions. As with many organic compounds, its behavior in different solvents and under varying conditions can significantly influence its reactivity and stability.
Formula:C13H14O
InChI:InChI=1S/C13H14O/c1-11(2)10-13(14)9-8-12-6-4-3-5-7-12/h3-10H,1-2H3
InChI key:InChIKey=OGKKCSAGHUIPND-UHFFFAOYSA-N
SMILES:C(=CC(C=C(C)C)=O)C1=CC=CC=C1
Synonyms:- 1,4-Hexadien-3-One, 5-Methyl-1-Phenyl-
- 5-Methyl-1-phenyl-1,4-hexadien-3-one
- 5-Methyl-1-phenylhexa-1,4-dien-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

