CAS 55904-84-2
:1,2,5-Thiadiazole, 3,4-diethoxy-, 1,1-dioxide
Description:
1,2,5-Thiadiazole, 3,4-diethoxy-, 1,1-dioxide, with the CAS number 55904-84-2, is a heterocyclic compound featuring a thiadiazole ring, which is a five-membered ring containing two nitrogen atoms and one sulfur atom. This compound is characterized by the presence of two ethoxy groups attached to the 3 and 4 positions of the thiadiazole ring, contributing to its unique chemical properties. The 1,1-dioxide designation indicates that the compound has two double-bonded oxygen atoms, which can influence its reactivity and stability. Typically, thiadiazoles exhibit interesting biological activities, making them of interest in pharmaceutical and agricultural chemistry. The presence of the ethoxy groups can enhance solubility and modify the electronic properties of the molecule. Overall, this compound is likely to be a solid at room temperature, with potential applications in various fields, including medicinal chemistry and materials science, due to its structural characteristics and functional groups.
Formula:C6H10N2O4S
InChI:InChI=1S/C6H10N2O4S/c1-3-11-5-6(12-4-2)8-13(9,10)7-5/h3-4H2,1-2H3
InChI key:InChIKey=WZMXSPCYRSRMJT-UHFFFAOYSA-N
SMILES:O(CC)C=1C(OCC)=NS(=O)(=O)N1
Synonyms:- 1,2,5-Thiadiazole, 3,4-diethoxy-, 1,1-dioxide
- 3,4-Diethoxy-1,2,5-thiadiazole-1,1-dione
- 3,4-Diethoxy-1,2,5-thiadiazole-1,1-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.