CAS 55934-00-4
:3,4-Dichloropyridine
Description:
3,4-Dichloropyridine is a heterocyclic aromatic compound characterized by a pyridine ring substituted with two chlorine atoms at the 3 and 4 positions. Its molecular formula is C5H3Cl2N, and it has a molecular weight that reflects the presence of these halogen substituents. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its moderate to high polarity, which influences its solubility in various organic solvents. 3,4-Dichloropyridine is utilized in the synthesis of agrochemicals, pharmaceuticals, and other fine chemicals, owing to its reactivity and ability to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, it exhibits some level of toxicity, necessitating careful handling and appropriate safety measures during use. Its environmental impact and potential for bioaccumulation are also considerations in its application and disposal.
Formula:C5H3Cl2N
InChI:InChI=1/C5H3Cl2N/c6-4-1-2-8-3-5(4)7/h1-3H
SMILES:c1cncc(c1Cl)Cl
Synonyms:- 3,4-Dichlorpyridin
- Pyridine, 3,4-dichloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-Dichloropyridine, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H3Cl2NPurity:98%Molecular weight:147.993,4-Dichloropyridine
CAS:3,4-DichloropyridineFormula:C5H3Cl2NPurity:97%Color and Shape:SolidMolecular weight:147.99g/mol3,4-Dichloropyridine
CAS:Formula:C5H3Cl2NPurity:98%Color and Shape:Low Melting SolidMolecular weight:147.99



