CAS 5594-30-9
:Methyl pheophorbide a
Description:
Methyl pheophorbide a is a chlorophyll derivative, specifically a type of pheophorbide, which is a breakdown product of chlorophyll. It is characterized by its complex porphyrin structure, which includes a central magnesium ion that is coordinated by a nitrogen-containing macrocycle. This compound is typically dark green in color and is soluble in organic solvents such as ethanol and acetone, but less soluble in water. Methyl pheophorbide a is known for its potential applications in photodynamic therapy due to its ability to absorb light and generate reactive oxygen species, making it useful in cancer treatment. Additionally, it can be utilized in studies related to photosynthesis and as a pigment in various biological and environmental research. Its stability and reactivity can be influenced by factors such as pH and the presence of other chemical species. Overall, methyl pheophorbide a serves as an important compound in both scientific research and potential therapeutic applications.
Formula:C36H38N4O5
InChI:InChI=1/C36H38N4O5/c1-9-20-16(3)23-13-25-18(5)22(11-12-29(41)44-7)33(39-25)31-32(36(43)45-8)35(42)30-19(6)26(40-34(30)31)15-28-21(10-2)17(4)24(38-28)14-27(20)37-23/h9,13-15,18,22,32,37-38H,1,10-12H2,2-8H3/b23-13-,24-14-,25-13-,26-15-,27-14-,28-15-,33-31-
InChI key:InChIKey=IWKYEJKHXKRZIJ-QYDDAJHMSA-N
SMILES:C(OC)(=O)[C@@H]1C=2C3=C(C1=O)C(C)=C(N3)C=C4C(CC)=C(C)C(=N4)C=C5NC(=CC6=NC2[C@@H](CCC(OC)=O)[C@@H]6C)C(C)=C5C=C
Synonyms:- methyl 9-ethenyl-14-ethyl-3-(3-methoxy-3-oxopropyl)-4,8,13,18-tetramethyl-20-oxo-24,25-dihydrophorbine-21-carboxylate
- 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, methyl ester, (3S,4S,21R)-
- Methyl phaeophorbide
- Methyl phaeophorbide A
- Phaeophorbid A, methyl ester
- Methylpheophorbide
- 3-Phorbinepropionic acid, 21-carboxy-14-ethyl-4,8,13,18-tetramethyl-20-oxo-9-vinyl-, dimethyl ester
- Pheophorbide a methyl ester
- 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, methyl ester, [3S-(3α,4β,21β)]-
- 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-, methyl ester, (3S-(3alpha,4beta,21beta))-
- Methyl (3S-(3alpha,4beta,21beta))-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-9-vinylphorbine-3-propionate
- 3-Phorbinepropionic acid, 21-carboxy-14-ethyl-4,8,13,18-tetramethyl-20-oxo-9-vinyl-, dimethyl ester (VAN) (8CI)
- Methyl pheophorbide a
- NSC 407320
- (3S)-9-Ethenyl-14-ethyl-21α-methoxycarbonyl-4α,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoic acid methyl ester
- Phaeophorbide a methyl ester
- Demagnesia chloric acid -a methyl ester
- Methylpheophorbide a
- PHEOPHORBIDEAMETHYLESTER
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methylpheophorbide A
CAS:Methylpheophorbide A is a chlorophyll derivative, which is a naturally occurring compound extracted from plant sources such as algae, leaves, and certain fruits. As a derivative of chlorophyll, it is obtained through processes that transform the central magnesium atom of chlorophyll into a more stable form, making it a key intermediate in the biosynthesis of other chlorophyll-based compounds.
Formula:C36H38N4O5Purity:Min. 95%Molecular weight:606.70 g/molRef: 3D-FAA59430
Discontinued product

