CAS 5595-15-3

5-Methyl-1,2,4-triazolo[4,3-a]pyridin-3-amine

Description:

5-Methyl-1,2,4-triazolo[4,3-a]pyridin-3-amine is a heterocyclic compound characterized by its triazole and pyridine rings, which contribute to its unique chemical properties. This compound features a methyl group at the 5-position of the triazole ring and an amino group at the 3-position of the pyridine ring, influencing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound's structure allows for various interactions, making it of interest in medicinal chemistry, particularly for its potential as a pharmacophore in drug development. Its CAS number, 5595-15-3, is a unique identifier that facilitates the search for information regarding its properties, synthesis, and applications in scientific literature. Overall, 5-Methyl-1,2,4-triazolo[4,3-a]pyridin-3-amine represents a versatile scaffold in organic synthesis and pharmaceutical research.

Formula: C₇H₈N₄

InChI: InChI=1S/C7H8N4/c1-5-3-2-4-6-9-10-7(8)11(5)6/h2-4H,1H3,(H2,8,10)

InChI key: InChIKey=YPKWGJNGPQESDL-UHFFFAOYSA-N

SMILES: CC=1N2C(C=CC1)=NN=C2N

Synonyms:

• 5-Methyl-1,2,4-triazolo[4,3-a]pyridin-3-amine
• 1,2,4-Triazolo[4,3-a]pyridin-3-amine, 5-methyl-
• s-Triazolo[4,3-a]pyridine, 3-amino-5-methyl-
• NSC 76485