CAS 55954-24-0
:Benzeneacetic acid, 3,5-dichloro-, methyl ester
Description:
Benzeneacetic acid, 3,5-dichloro-, methyl ester, also known by its CAS number 55954-24-0, is an organic compound characterized by its aromatic structure and the presence of both ester and carboxylic acid functional groups. This compound features a benzene ring substituted with two chlorine atoms at the 3 and 5 positions, which contributes to its chemical reactivity and potential biological activity. The methyl ester group indicates that the carboxylic acid is esterified with methanol, enhancing its solubility in organic solvents. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the aromatic system, which can influence their behavior in biological systems. The presence of chlorine substituents may also impart unique properties, such as increased stability and altered reactivity compared to non-chlorinated analogs. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications and the biological activity often associated with chlorinated aromatic compounds.
Formula:C9H8Cl2O2
InChI:InChI=1S/C9H8Cl2O2/c1-13-9(12)4-6-2-7(10)5-8(11)3-6/h2-3,5H,4H2,1H3
InChI key:InChIKey=ZKVZUSKNUTWXHC-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1=CC(Cl)=CC(Cl)=C1
Synonyms:- (3,5-Dichlorophenyl)acetic acid methyl ester
- Methyl 2-(3,5-dichlorophenyl)acetate
- Benzeneacetic acid, 3,5-dichloro-, methyl ester
- Methyl (3,5-dichlorophenyl)acetate
- Methyl 3,5-dichlorobenzeneacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(3,5-Dichloro-phenyl)-acetic acid methyl ester
CAS:Formula:C9H8Cl2O2Purity:97%Molecular weight:219.0646Methyl 3,5-dichlorobenzeneacetate
CAS:<p>Methyl 3,5-dichlorobenzeneacetate is a chemical compound that is used as a reagent for organic synthesis. It is also known as 1,3-dichloro-5-methylbenzeneacetic acid methyl ester and has the chemical formula CHClO. Methyl 3,5-dichlorobenzeneacetate can be prepared by reacting copper with nitrobenzene in the presence of an esterifying agent such as pyridine or acetic anhydride. This chemical has been shown to be useful as a catalyst for biomolecular reactions involving nitrogen sources. Methyl 3,5-dichlorobenzeneacetate can also be used as a nitrogen source in imidazolinones.</p>Formula:C9H8Cl2O2Purity:Min. 95%Molecular weight:219.06 g/mol

