CAS 55977-58-7

quinoxalino[2,3-b]quinoxaline

Description:

Quinoxalino[2,3-b]quinoxaline is a heterocyclic compound characterized by its fused quinoxaline rings, which contribute to its unique chemical properties. This compound typically exhibits a planar structure, allowing for effective π-π stacking interactions, which can influence its electronic properties and potential applications in materials science and organic electronics. It is known for its fluorescence properties, making it of interest in the development of fluorescent probes and sensors. The presence of nitrogen atoms in the ring structure can also impart basicity and influence its reactivity, particularly in electrophilic and nucleophilic reactions. Quinoxalino[2,3-b]quinoxaline may be utilized in various fields, including organic synthesis, medicinal chemistry, and as a building block for more complex molecular architectures. Its CAS number, 55977-58-7, allows for easy identification in chemical databases. Overall, this compound's unique structural features and properties make it a subject of interest in both academic research and potential industrial applications.

Formula: C₁₄H₈N₄

InChI: InChI=1/C14H8N4/c1-2-6-10-9(5-1)15-13-14(16-10)18-12-8-4-3-7-11(12)17-13/h1-8H

SMILES: c1ccc2c(c1)nc1c(n2)nc2ccccc2n1

6,11-Dihydroquinoxalino[2,3-b]quinoxaline

CAS: 55977-58-7

Polyvinyl chloride (PVC) is a polymer that is typically used in the production of plastic products. PVC can be made into a variety of shapes and sizes, such as sheets and pipes. The most common type of PVC is polyvinyl chloride with a density range from 0.91 to 0.94 g/cm3. PVC has excellent heat resistance, electrical properties, and chemical resistance, which makes it an ideal material for manufacturing many types of items. Polyvinyl chloride is also resistant to mold or mildew growth.

Formula: C₁₄H₁₀N₄

Purity: Min. 95%

Molecular weight: 234.26 g/mol

Ref: 3D-FCA97758