CAS 5598-38-9

Homo-γ-linoleic acid

Description:

Homo-γ-linoleic acid, also known as 5,9,12-octadecatrienoic acid, is a polyunsaturated fatty acid characterized by its three double bonds located at the 5th, 9th, and 12th carbon positions of the carbon chain. It is a derivative of linoleic acid and belongs to the omega-6 fatty acid family. This compound is typically found in various plant oils and is known for its potential health benefits, including anti-inflammatory properties and roles in cellular signaling. Homo-γ-linoleic acid is often studied for its effects on skin health and its potential therapeutic applications in conditions such as eczema and other inflammatory disorders. The presence of multiple double bonds contributes to its fluidity and reactivity, making it an important component in biological membranes. Additionally, it can be metabolized into other bioactive lipids, influencing various physiological processes. As with many fatty acids, its stability can be affected by factors such as temperature and exposure to light, which can lead to oxidation and degradation.

Formula: C₂₀H₃₆O₂

InChI: InChI=1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10H,2-5,8,11-19H2,1H3,(H,21,22)/b7-6-,10-9-

InChI key: InChIKey=XSXIVVZCUAHUJO-HZJYTTRNSA-N

SMILES: C(CC/C=C\C/C=C\CCCCC)CCCCCCC(O)=O

Synonyms:

• cis-11,cis-14-Eicosadienoic acid
• cis,cis-Δ11,14-Eicosadienoic acid
• 11,14-Eicosadienoic acid, (11Z,14Z)-
• 11,14-Eicosadienoic acid, (Z,Z)-
• (11Z,14Z)-11,14-Eicosadienoic acid

11(Z),14(Z)-Eicosadienoic Acid

CAS: 5598-38-9

Formula: C₂₀H₃₆O₂

Purity: 99%

Molecular weight: 308.4986

Ref: IN-DA00DXHT

11(Z),14(Z)-Eicosadienoic acid

CAS: 5598-38-9

11(Z),14(Z)-Eicosadienoic acid

Purity: ≥98%

Molecular weight: 308.5g/mol

Ref: 54-BUP20915

11(Z),14(Z)-Eicosadienoic acid

CAS: 5598-38-9

Formula: C20H36O2

Purity: >99%

Color and Shape: Liquid

Molecular weight: 308.5

Ref: 48-10-2002

(11Z,14Z)-Eicosadienoic acid

CAS: 5598-38-9

(11Z,14Z)-Eicosadienoic acid is a bioactive lipid molecule, which is a polyunsaturated fatty acid derived from natural sources such as marine organisms and certain plant oils. It acts primarily through incorporation into cell membranes where it modulates membrane fluidity and serves as a precursor for bioactive lipid mediators. These mediators play a crucial role in inflammatory pathways, potentially exerting anti-inflammatory effects through competitive inhibition of enzymes involved in the eicosanoid synthesis pathway.

Formula: C₂₀H₃₆O₂

Purity: Min. 95%

Molecular weight: 308.5 g/mol

Ref: 3D-FAA59838

11(Z),14(Z)-Eicosadienoic acid

CAS: 5598-38-9

11(Z),14(Z)-Eicosadienoic acid is an unsaturated fatty acid and metabolite that inhibits the binding of [3H]LTB4 to neutrophil modules (Ki=3 μm).

Formula: C₂₀H₃₆O₂

Purity: 99.94%

Color and Shape: Solid

Molecular weight: 308.5

Ref: TM-T84631