CAS 55990-13-1

2-{[(3-aminophenyl)sulfonyl]amino}benzoate

Description:

2-{[(3-Aminophenyl)sulfonyl]amino}benzoate, with the CAS number 55990-13-1, is a chemical compound that features a sulfonamide functional group, which is characterized by the presence of a sulfonyl group (–SO2–) attached to an amino group. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its polar nature due to the sulfonamide and carboxylate functionalities. It exhibits properties typical of sulfonamides, including potential antibacterial activity, although its specific biological activity may vary. The presence of both an amino group and a carboxylate group suggests that it can participate in various chemical reactions, including hydrogen bonding and ionic interactions. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its structural characteristics allow for potential modifications that could enhance its efficacy or selectivity in biological applications.

Formula: C₁₃H₁₁N₂O₄S

InChI: InChI=1/C13H12N2O4S/c14-9-4-3-5-10(8-9)20(18,19)15-12-7-2-1-6-11(12)13(16)17/h1-8,15H,14H2,(H,16,17)/p-1

SMILES: c1ccc(c(c1)C(=O)[O-])NS(=O)(=O)c1cccc(c1)N

2-(3-Amino-benzenesulfonylamino)-benzoic acid

CAS: 55990-13-1

Purity: 95%

Molecular weight: 292.3099976

Ref: 10-F639102

2-(3-Amino-benzenesulfonylamino)-benzoic acid

CAS: 55990-13-1

Versatile small molecule scaffold

Formula: C₁₃H₁₂N₂O₄S

Purity: Min. 95%

Molecular weight: 292.31 g/mol

Ref: 3D-FCA99013