CAS 55996-27-5
:Ethyl 2-ethoxy-1,6-dihydro-6-oxo-5-pyrimidinecarboxylate
Description:
Ethyl 2-ethoxy-1,6-dihydro-6-oxo-5-pyrimidinecarboxylate, with the CAS number 55996-27-5, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The compound is characterized by the presence of an ethoxy group and an ethyl ester functional group, contributing to its solubility and reactivity. It typically appears as a solid or liquid, depending on the specific conditions, and may exhibit moderate to high polarity due to the presence of the carboxylate moiety. Ethyl 2-ethoxy-1,6-dihydro-6-oxo-5-pyrimidinecarboxylate may be utilized in various chemical syntheses and pharmaceutical applications, particularly in the development of biologically active compounds. Its reactivity can be influenced by the functional groups attached to the pyrimidine core, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H12N2O4
InChI:InChI=1S/C9H12N2O4/c1-3-14-8(13)6-5-10-9(15-4-2)11-7(6)12/h5H,3-4H2,1-2H3,(H,10,11,12)
InChI key:InChIKey=WQQKLRMVMBJSJS-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(=O)NC(OCC)=NC1
Synonyms:- 5-Pyrimidinecarboxylic acid, 2-ethoxy-1,4-dihydro-4-oxo-, ethyl ester
- 5-Pyrimidinecarboxylic acid, 2-ethoxy-1,6-dihydro-6-oxo-, ethyl ester
- Ethyl 2-ethoxy-1,6-dihydro-6-oxo-5-pyrimidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
