CAS 56-12-2

γ-Aminobutyric acid

Description:

γ-Aminobutyric acid, commonly known as GABA, is a non-proteinogenic amino acid that serves as a key neurotransmitter in the central nervous system. It is characterized by its four-carbon backbone, with an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the terminal carbon. GABA plays a crucial role in inhibiting neuronal excitability throughout the nervous system, thus contributing to the regulation of muscle tone and the modulation of anxiety and stress responses. It is a colorless, odorless solid that is soluble in water, making it bioavailable for various physiological functions. GABA is synthesized in the brain from glutamate, another amino acid, through the action of the enzyme glutamic acid decarboxylase. Its therapeutic applications include the treatment of anxiety disorders, epilepsy, and other neurological conditions. Additionally, GABA is often studied for its potential effects on sleep regulation and cognitive function. As a dietary supplement, it is marketed for its purported calming effects, although its efficacy when taken orally remains a topic of ongoing research.

Formula:C₄H₉NO₂

InChI:InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)

InChI key:InChIKey=BTCSSZJGUNDROE-UHFFFAOYSA-N

SMILES:C(C(O)=O)CCN

Synonyms: