CAS 560-27-0
:Dihydroxymalonic acid
Description:
Dihydroxymalonic acid, with the CAS number 560-27-0, is an organic compound characterized by its two hydroxyl (-OH) groups and a malonic acid backbone. It is a dicarboxylic acid, which means it contains two carboxylic acid functional groups (-COOH). The presence of hydroxyl groups contributes to its solubility in water and its potential to participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Dihydroxymalonic acid is typically a white crystalline solid at room temperature and can be synthesized through various chemical reactions involving malonic acid derivatives. Its structure allows it to act as a building block in organic synthesis and may have applications in pharmaceuticals and biochemistry. The compound's acidity is influenced by the carboxylic groups, and it can undergo various reactions typical of dicarboxylic acids, such as esterification and decarboxylation. Overall, dihydroxymalonic acid is a versatile compound with properties that make it useful in various chemical applications.
Formula:C3H4O6
InChI:InChI=1S/C3H4O6/c4-1(5)3(8,9)2(6)7/h8-9H,(H,4,5)(H,6,7)
InChI key:InChIKey=VUCKYGJSXHHQOJ-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C(O)=O)(O)O
Synonyms:- 2,2-Dihydroxypropanedioic acid
- Dihydroxymalonic acid
- Dihydroxypropanedioic Acid
- Malonic acid, dihydroxy-
- Mesoxalic acid, hydrate
- Propanedioic acid, 2,2-dihydroxy-
- Propanedioic acid, dihydroxy-
- Propanedioic acid, oxo-, hydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
