
CAS 560-53-2
:k-Strophanthin-β
Description:
K-Strophanthin-β, also known as strophanthin, is a cardiac glycoside derived from the seeds of the Strophanthus plant. It is characterized by its ability to inhibit the Na+/K+ ATPase enzyme, leading to increased intracellular sodium and calcium concentrations, which enhances cardiac contractility. This compound is typically used in pharmacology for its potential therapeutic effects in treating heart conditions, particularly heart failure and arrhythmias. K-Strophanthin-β exhibits a relatively low solubility in water but is more soluble in organic solvents, which influences its bioavailability and pharmacokinetics. Its structure includes a steroid nucleus with a sugar moiety, contributing to its biological activity. The compound is known for its narrow therapeutic window, necessitating careful dosing and monitoring in clinical settings. Additionally, it can have significant side effects, including toxicity, which underscores the importance of understanding its pharmacodynamics and pharmacokinetics in therapeutic applications. Overall, K-Strophanthin-β is a potent agent with specific applications in cardiology, but it requires careful management due to its potential risks.
Formula:C36H54O14
InChI:InChI=1S/C36H54O14/c1-18-31(50-32-30(42)29(41)28(40)25(15-37)49-32)24(45-3)13-27(47-18)48-20-4-9-34(17-38)22-5-8-33(2)21(19-12-26(39)46-16-19)7-11-36(33,44)23(22)6-10-35(34,43)14-20/h12,17-18,20-25,27-32,37,40-44H,4-11,13-16H2,1-3H3/t18-,20+,21-,22+,23-,24+,25-,27+,28-,29+,30-,31-,32+,33-,34+,35+,36+/m1/s1
InChI key:InChIKey=FHIREUBIEIPPMC-SADZTDHOSA-N
SMILES:C(=O)[C@@]12[C@@]3([C@]([C@]4(O)[C@](C)(CC3)[C@H](CC4)C=5COC(=O)C5)(CC[C@]1(O)C[C@@H](O[C@H]6C[C@H](OC)[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@@H](C)O6)CC2)[H])[H]
Synonyms:- Card-20(22)-enolide, 3-[(2,6-dideoxy-4-O-β-D-glucopyranosyl-3-O-methyl-β-D-xylo-hexopyranosyl)oxy]-5,14-dihydroxy-19-oxo-, (3β,5β)-
- k-Strophanthin-β
- (3β,5β)-3-[(2,6-Dideoxy-4-O-β-D-glucopyranosyl-3-O-methyl-β-D-ribo-hexopyranosyl)oxy]-5,14-dihydroxy-19-oxocard-20(22)-enolide
- NSC 4320
- β-k-Strophanthin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
K-Strophanthin-?
CAS:K-Strophanthin-? is a useful organic compound for research related to life sciences. The catalog number is T124653 and the CAS number is 560-53-2.Formula:C36H54O14Color and Shape:SolidMolecular weight:710.814
