CAS 560-66-7
:Eburicoic acid
Description:
Eburicoic acid, with the CAS number 560-66-7, is a naturally occurring organic compound classified as a triterpenoid. It is primarily derived from the bark of certain trees, particularly those in the genus Eucalyptus. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its chemical properties. Eburicoic acid exhibits a range of biological activities, including anti-inflammatory and antimicrobial effects, making it of interest in pharmacological research. Its solubility is generally low in water but can dissolve in organic solvents, which is typical for many triterpenoids. The compound's stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Eburicoic acid is also studied for its potential applications in traditional medicine and as a natural product in various formulations. Overall, its unique structure and biological properties make it a subject of interest in both chemistry and medicinal research.
Formula:C31H50O3
InChI:InChI=1/C31H50O3/c1-19(2)20(3)9-10-21(27(33)34)22-13-17-31(8)24-11-12-25-28(4,5)26(32)15-16-29(25,6)23(24)14-18-30(22,31)7/h19,21-22,25-26,32H,3,9-18H2,1-2,4-8H3,(H,33,34)/t21-,22-,25+,26+,29-,30-,31+/m1/s1
InChI key:InChIKey=UGMQOYZVOPASJF-OXUZYLMNSA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](O)CC4)[H])CC[C@]1(C)[C@@]([C@@H](CCC(C(C)C)=C)C(O)=O)(CC2)[H]
Synonyms:- (3β)-3-Hydroxy-24-methylenelanost-8-en-21-oic acid
- 3β-Hydroxy-24-methylene-8-lanosten-21-oic acid
- Eburcoic acid
- Eburicoic acid
- Lanost-8-En-21-Oic Acid, 3-Hydroxy-24-Methylene-, (3Beta)-
- Lanost-8-en-21-oic acid, 3-hydroxy-24-methylene-, (3β)-
- Lanost-8-en-21-oic acid, 3β-hydroxy-24-methylene-
- NSC 41969
- (2R)-2-[(3S,5S,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3 ,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-m ethyl-5-methylidene-heptanoic acid
- 3beta-Hydroxy-24-methylene-8-lanosten-21-oic acid
- Eburicoicaci
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-2-((3S,5R,10S,13R,14R,17R)-3-Hydroxy-4,4,10,13,14-pentamethyl-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methyl-5-methyleneheptanoic acid
CAS:Formula:C31H50O3Purity:94%Color and Shape:SolidMolecular weight:470.7269Eburicoic acid
CAS:Eburicoic acid (ZINC4655149) exhibits anti-inflammatory and antioxidant activity thereby protecting the liver from CCl4-induced hepatic damage and can be usedFormula:C31H50O3Purity:97.87%Color and Shape:SolidMolecular weight:470.73Eburicoic acid
CAS:Controlled ProductEburicoic acid is a lanostane-type triterpenoid, which is a secondary metabolite primarily obtained from fungi, notably those in the Polyporaceae family. This compound features a complex molecular structure characteristic of triterpenoids, which are known for diverse biological activities. The source of eburicoic acid is crucial in understanding its biosynthesis and ecological roles within its native fungal hosts.Formula:C31H50O3Purity:Min. 95%Color and Shape:PowderMolecular weight:470.73 g/mol




