CAS 56004-62-7
:(3-methylthiophen-2-yl)(phenyl)methanone
Description:
(3-Methylthiophen-2-yl)(phenyl)methanone, with the CAS number 56004-62-7, is an organic compound characterized by its unique structure, which includes a thiophene ring substituted with a methyl group and a phenyl group attached to a carbonyl moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and distinct reactivity patterns due to the presence of the carbonyl group. It is likely to be a solid at room temperature, with potential applications in organic synthesis and materials science. The presence of both the thiophene and phenyl groups suggests that it may exhibit interesting electronic properties, making it a candidate for studies in organic electronics or as a building block in the synthesis of more complex molecules. Additionally, the compound may show moderate solubility in organic solvents, which is common for similar aromatic compounds. Its reactivity can be influenced by the electron-donating and electron-withdrawing effects of the substituents, making it a versatile compound in various chemical reactions.
Formula:C12H10OS
InChI:InChI=1/C12H10OS/c1-9-7-8-14-12(9)11(13)10-5-3-2-4-6-10/h2-8H,1H3
SMILES:Cc1ccsc1C(=O)c1ccccc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(3-Methylthiophen-2-yl)(phenyl)methanone
CAS:(3-Methylthiophen-2-yl)(phenyl)methanone is an organic compound that belongs to the class of substituted thiophenes. This compound has been synthesized by thermally or photochemically induced cycloaddition of 2-benzoylthiophene and methyl acetylene. The compound has a triplet emission with a maximum at 637 nm. It also reacts with isobutylene in the presence of ultraviolet light to form a carbonyl group. This reaction is used for the detection of isobutylene in air, as it produces a strong absorption band at 515 nm.Formula:C12H10OSPurity:Min. 95%Molecular weight:202.27 g/mol
