CAS 56009-40-6
:dl-A-hydroxymyristic acid methyl ester
Description:
dl-A-Hydroxymyristic acid methyl ester, with the CAS number 56009-40-6, is an ester derived from myristic acid, a saturated fatty acid. This compound features a hydroxyl group (-OH) at the alpha position relative to the carboxylic acid group, which contributes to its unique properties. It is typically a colorless to pale yellow liquid with a characteristic fatty odor. The presence of the hydroxyl group enhances its solubility in polar solvents compared to its non-hydroxylated counterparts, making it useful in various applications, including as a surfactant or emulsifier in cosmetic formulations. Additionally, its fatty acid structure allows it to participate in biochemical processes, potentially serving as a precursor in the synthesis of more complex lipids. The compound is generally stable under standard conditions but may undergo hydrolysis in the presence of strong acids or bases. Its safety profile should be assessed, as with any chemical substance, particularly regarding skin and eye irritation potential.
Formula:C15H30O3
InChI:InChI=1/C15H30O3/c1-3-4-5-6-7-8-9-10-11-12-13-14(16)15(17)18-2/h14,16H,3-13H2,1-2H3
SMILES:CCCCCCCCCCCCC(C(=O)OC)O
Synonyms:- Methyl 2-Hydroxytetradecanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 2-Hydroxytetradecanoate
CAS:Formula:C15H30O3Purity:>98%Color and Shape:SolidMolecular weight:258.42-hydroxy Myristic Acid methyl ester
CAS:2-Hydroxy Myristic Acid Methyl Ester, a rare hydroxylated fatty acid methyl ester isolated from aquatic microbial sources, experiences a decrease in levels to <1% within these communities following Atradex pesticide exposure at 245 mg/L concentration. [Matreya, LLC. Catalog No. 1704]Formula:C15H30O3Color and Shape:SolidMolecular weight:258.402


