CAS 560132-24-3
:(3-tert-butylphenyl)boronic acid
Description:
(3-tert-Butylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a tert-butyl substituent at the meta position. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It exhibits properties typical of boronic acids, including the ability to form reversible complexes with diols, which makes it useful in various applications such as organic synthesis and medicinal chemistry. The presence of the tert-butyl group enhances its steric bulk, which can influence its reactivity and selectivity in chemical reactions. Additionally, (3-tert-butylphenyl)boronic acid can participate in Suzuki-Miyaura cross-coupling reactions, making it valuable in the formation of carbon-carbon bonds. Its boronic acid functionality also allows for potential applications in sensor technology and drug delivery systems. Overall, this compound is significant in both academic research and industrial applications due to its versatile reactivity and functional properties.
Formula:C10H15BO2
InChI:InChI=1/C10H15BO2/c1-10(2,3)8-5-4-6-9(7-8)11(12)13/h4-7,12-13H,1-3H3
SMILES:CC(C)(C)c1cccc(c1)B(O)O
Synonyms:- Boronic acid, B-[3-(1,1-dimethylethyl)phenyl]-
- 3-tert-Butylphenylboronic acid
- (3-tert-Butylphenyl)boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-tert-Butylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C10H15BO2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:178.04M-T-BUTYLPHENYLBORONIC ACID
CAS:Formula:C10H15BO2Purity:96%Color and Shape:SolidMolecular weight:178.03593-tert-Butylphenylboronic acid
CAS:3-tert-Butylphenylboronic acidPurity:98%Molecular weight:178.04g/mol3-tert-Butylbenzene boronic acid
CAS:Formula:C10H15BO2Purity:95%Color and Shape:Off-white powderMolecular weight:178.043-tert-Butylphenylboronic acid
CAS:<p>3-tert-Butylphenylboronic acid (3TBBA) is an antibacterial agent that is used to treat bacterial infections. 3TBBA has been shown to be effective against methicillin-resistant Staphylococcus aureus and other bacteria. The mechanism of action of this drug is not well understood, but it may involve the inhibition of DNA synthesis. 3TBBA binds with high affinity to the enzyme RNA polymerase in the bacterial ribosome and inhibits its activity, leading to cell death by inhibiting protein synthesis. 3TBBA also has optical properties that can be seen using absorption spectroscopy and ultrafast spectroscopy methods.</p>Formula:C10H15BO2Purity:Min. 95%Molecular weight:178.04 g/mol




