CymitQuimica logo

CAS 56015-31-7

:

7-bromo-5H-pyrrolo[2,3-b]pyrazine

Description:
7-Bromo-5H-pyrrolo[2,3-b]pyrazine is a heterocyclic organic compound characterized by its fused bicyclic structure, which includes both a pyrrole and a pyrazine moiety. The presence of a bromine atom at the 7-position contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitutions. This compound typically exhibits a pale to dark color in solid form and is soluble in organic solvents, making it useful in synthetic organic chemistry. Its unique structure allows for interactions with biological systems, which may lead to applications in pharmaceuticals or agrochemicals. The compound's molecular framework can facilitate the formation of coordination complexes with metals, enhancing its utility in materials science. Additionally, the presence of nitrogen atoms in the rings can influence its electronic properties, making it a candidate for studies in electronic materials or as a ligand in coordination chemistry. Overall, 7-bromo-5H-pyrrolo[2,3-b]pyrazine is a versatile compound with potential applications across various fields of chemistry.
Formula:C6H4BrN3
InChI:InChI=1/C6H4BrN3/c7-4-3-10-6-5(4)8-1-2-9-6/h1-3H,(H,9,10)
InChI key:BIVCAYYYCIWBLQ-UHFFFAOYSA-N
SMILES:c1c[nH]c2c(c(cn2)Br)n1
Synonyms:
  • 5H-pyrrolo[2,3-b]pyrazine, 7-bromo-
Found 4 products.