CAS 5602-19-7
:6-Cyanohexanoic acid
Description:
6-Cyanohexanoic acid, with the CAS number 5602-19-7, is an organic compound characterized by its cyano group (-CN) and carboxylic acid group (-COOH) attached to a six-carbon aliphatic chain. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its polar nature due to the presence of both the cyano and carboxylic acid functional groups, which can engage in hydrogen bonding and dipole-dipole interactions. 6-Cyanohexanoic acid is soluble in polar solvents such as water and alcohols, making it useful in various chemical applications. It is often utilized as an intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, its reactivity allows it to participate in various chemical reactions, including esterification and amidation. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate protective measures should be taken.
Formula:C7H11NO2
InChI:InChI=1S/C7H11NO2/c8-6-4-2-1-3-5-7(9)10/h1-5H2,(H,9,10)
InChI key:InChIKey=INHNHRQXVDVIDZ-UHFFFAOYSA-N
SMILES:C(CCCC#N)CC(O)=O
Synonyms:- ε-Cyanocaproic acid
- 6-Cyanocaproic acid
- Hexanoic acid, 6-cyano-
- 6-Cyanohexanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6-Cyanohexanoic acid
CAS:6-Cyanohexanoic acid is a compound that belongs to the group of oximes. It is a deacetylase inhibitor, which inhibits the activity of histone deacetylases (HDACs). 6-Cyanohexanoic acid has been shown to inhibit HDACs in vitro and in vivo. 6-Cyanohexanoic acid also functions as an acetylcholinesterase inhibitor, and can be used for the treatment of Alzheimer's disease. This molecule has been shown to be effective against aluminium toxicity, by reducing its accumulation in the brain. 6-Cyanohexanoic acid also inhibits crotonoyl-CoA reductase, which can be used as a potential treatment for metabolic diseases such as type 2 diabetes.
Formula:C7H11NO2Purity:Min. 95%Molecular weight:141.17 g/mol
