CAS 56025-89-9
:2-Chloro-7-(phenylmethyl)-7H-purin-6-amine
Description:
2-Chloro-7-(phenylmethyl)-7H-purin-6-amine, with the CAS number 56025-89-9, is a purine derivative characterized by its structural features that include a chlorine atom at the 2-position and a phenylmethyl group at the 7-position of the purine ring. This compound exhibits properties typical of purines, such as potential biological activity, particularly in the context of nucleic acid metabolism and enzyme interactions. It may act as a substrate or inhibitor in various biochemical pathways. The presence of the chlorine atom can influence its reactivity and solubility, while the phenylmethyl group may enhance lipophilicity, affecting its pharmacokinetic properties. The compound's molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. As with many purine analogs, it may exhibit a range of biological activities, including antiviral or anticancer properties, making it a subject of research in drug development.
Formula:C12H10ClN5
InChI:InChI=1S/C12H10ClN5/c13-12-16-10(14)9-11(17-12)15-7-18(9)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,14,16,17)
InChI key:InChIKey=YRLFBWHEVKVQSG-UHFFFAOYSA-N
SMILES:C(N1C=2C(N=C1)=NC(Cl)=NC2N)C3=CC=CC=C3
Synonyms:- 6-Amino-2-chloro-7-benzylpurine
- 2-Chloro-6-amino-7-benzylpurine
- 7H-Purin-6-amine, 2-chloro-7-(phenylmethyl)-
- 2-Chloro-7-(phenylmethyl)-7H-purin-6-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.