CAS 56026-36-9
:Methyl 6-(hydroxymethyl)nicotinate
Description:
Methyl 6-(hydroxymethyl)nicotinate, with the CAS number 56026-36-9, is an organic compound derived from nicotinic acid. It features a methyl ester functional group and a hydroxymethyl substituent at the 6-position of the pyridine ring. This compound is typically characterized by its white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, which is indicative of its polar functional groups. Methyl 6-(hydroxymethyl)nicotinate is known for its potential applications in pharmaceuticals and biochemistry, particularly in the synthesis of various derivatives and as a building block in medicinal chemistry. Its structure allows for interactions with biological systems, making it of interest in studies related to drug development and metabolic pathways. Additionally, it may exhibit biological activities, including anti-inflammatory or antioxidant properties, although specific biological effects would depend on further empirical studies. As with many chemical substances, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C8H9NO3
InChI:InChI=1/C8H9NO3/c1-12-8(11)6-2-3-7(5-10)9-4-6/h2-4,10H,5H2,1H3
SMILES:COC(=O)c1ccc(CO)nc1
Synonyms:- 6-Hydroxymethyl-nicotinic acid methyl ester
- Methyl 6-(Hydroxymethyl)Pyridine-3-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 6-(Hydroxymethyl)nicotinate
CAS:Formula:C8H9NO3Purity:>97.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:167.163-Pyridinecarboxylicacid, 6-(hydroxymethyl)-, methyl ester
CAS:Formula:C8H9NO3Purity:95%Color and Shape:SolidMolecular weight:167.1620Ref: IN-DA00372N
1g30.00€5g62.00€10g85.00€25g159.00€50g229.00€100g521.00€250gTo inquire500gTo inquire100mg22.00€250mg26.00€6-Hydroxymethyl-nicotinic acid methyl ester
CAS:6-Hydroxymethyl-nicotinic acid methyl esterFormula:C8H9NO3Purity:95Color and Shape: off-white to yellow solidMolecular weight:167.16g/molMethyl 6-(Hydroxymethyl)nicotinate
CAS:Formula:C8H9NO3Purity:95%Color and Shape:SolidMolecular weight:167.164



