CAS 56035-64-4

2,4-dichloro-6-methylpyrimidine-5-carbonitrile

Description:

2,4-Dichloro-6-methylpyrimidine-5-carbonitrile is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains two chlorine substituents at the 2 and 4 positions, a methyl group at the 6 position, and a cyano group at the 5 position. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the cyano group contributes to its reactivity, making it useful in various synthetic pathways. Additionally, the dichloro and methyl groups influence its physical properties, such as solubility and melting point. As a member of the pyrimidine family, it exhibits characteristics common to nitrogen-containing heterocycles, including potential for hydrogen bonding and interactions with biological targets. Safety data should be consulted for handling and exposure, as halogenated compounds can pose environmental and health risks.

Formula: C₆H₃Cl₂N₃

InChI: InChI=1/C6H3Cl2N3/c1-3-4(2-9)5(7)11-6(8)10-3/h1H3

SMILES: Cc1c(C#N)c(Cl)nc(Cl)n1

Synonyms:

• 5-Pyrimidinecarbonitrile, 2,4-dichloro-6-methyl-
• 2,4-Dichloro-6-methylpyrimidine-5-carbonitrile

2,4-Dichloro-6-methylpyrimidine-5-carbonitrile

CAS: 56035-64-4

Formula: C₆H₃Cl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.0141

Ref: IN-DA003FQU

2,4-Dichloro-6-methylpyrimidine-5-carbonitrile

CAS: 56035-64-4

2,4-Dichloro-6-methylpyrimidine-5-carbonitrile

Purity: 95%

Molecular weight: 188.01g/mol

Ref: 54-OR951649

2,4-Dichloro-6-methylpyrimidine-5-carbonitrile

CAS: 56035-64-4

Formula: C₆H₃Cl₂N₃

Purity: 97%

Molecular weight: 188.01

Ref: 10-F220256

2,4-Dichloro-6-methylpyrimidine-5-carbonitrile

CAS: 56035-64-4

2,4-Dichloro-6-methylpyrimidine-5-carbonitrile is an efficient and inexpensive reagent for the synthesis of 2,6-dichloro-4-(trifluoromethyl)pyrimidine. It is a chlorinating agent that can be used in place of chlorine gas, which is expensive. The methylation reaction proceeds efficiently with n-butyl alcohol as the methylating agent, giving a high yield of product. The synthesis method has been shown to be effective for the preparation of this chemical.

Formula: C₆H₃Cl₂N₃

Purity: Min. 95%

Molecular weight: 188.01 g/mol

Ref: 3D-GCA03564