CAS 56039-11-3

6-amino-1-(beta-D-ribofuranosyl)-1,5-dihydro-4H-imidazo[4,5-c]pyridin-4-one

Description:

6-Amino-1-(beta-D-ribofuranosyl)-1,5-dihydro-4H-imidazo[4,5-c]pyridin-4-one, commonly known as a nucleoside analog, is characterized by its unique structural features that include an imidazopyridine core and a ribofuranosyl moiety. This compound exhibits properties typical of nucleosides, such as the ability to participate in hydrogen bonding and potential interactions with nucleic acid structures. Its amino group contributes to its reactivity and solubility in polar solvents, while the ribofuranosyl component enhances its biological relevance, particularly in the context of antiviral and anticancer research. The compound's structure allows it to mimic natural nucleosides, making it a candidate for incorporation into RNA or DNA, which can affect nucleic acid synthesis and function. Additionally, its imidazo[4,5-c]pyridine framework may confer specific pharmacological activities, making it of interest in medicinal chemistry. Overall, this compound's characteristics position it as a significant molecule in biochemical and pharmaceutical studies.

Formula: C₁₁H₁₄N₄O₅

InChI: InChI=1/C11H14N4O5/c12-6-1-4-7(10(19)14-6)13-3-15(4)11-9(18)8(17)5(2-16)20-11/h1,3,5,8-9,11,16-18H,2H2,(H3,12,14,19)/t5-,8-,9-,11-/m1/s1

SMILES: c1c2c(c([nH]c1=N)O)ncn2[C@H]1[C@@H]([C@@H]([C@@H](CO)O1)O)O

Synonyms:

• 6-Amino-1-.beta.-d-ribofuranosylimidazo[4,5-c]pyridin-4(5H)-one

3-Deazaguanosine

CAS: 56039-11-3

Ref: 7W-GN9068

3-Deazaguanosine

Controlled Product

CAS: 56039-11-3

Formula: C₁₁H₁₄N₄O₅

Color and Shape: Neat

Molecular weight: 282.25

Ref: TR-D201380

3-Deazaguanosine

CAS: 56039-11-3

3-Deazaguanosine is a nucleotide that is found in uridine, which is present in the nucleic acids of all cells. It has been shown to be cytotoxic to colorectal adenocarcinoma and carcinoma cell lines, and this cytotoxicity may be due to its ability to inhibit energy metabolism. 3-Deazaguanosine has also been shown to significantly inhibit viral replication, including HIV and herpes simplex virus type 1. It binds with high affinity to monoclonal antibodies that are specific for nucleotide levels. 3-Deazaguanosine inhibits tissue culture enzyme activity and can cause significant changes in adenine nucleotide levels in cell culture.

Formula: C₁₁H₁₄N₄O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 282.25 g/mol

Ref: 3D-ND30048

3-Deazaguanosine

CAS: 56039-11-3

3-Deazaguanosine (C3Guo) exhibits potent antiviral activity against SARS-CoV-2 with an EC50 of 1.14 μM and a CC50 greater than 200 μM in Vero E6 cells. It has the potential to prevent COVID-19.

Formula: C₁₁H₁₄N₄O₅

Color and Shape: Solid

Molecular weight: 282.25

Ref: TM-T207642