CAS 56059-28-0
:methyl (5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetate
Description:
Methyl (5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetate is a chemical compound that belongs to the class of pyrimidine derivatives. It features a pyrimidine ring substituted with a fluorine atom and two carbonyl groups, contributing to its dioxo functionality. The presence of the methyl acetate moiety indicates that it has an ester functional group, which can influence its reactivity and solubility. This compound is typically characterized by its potential biological activity, often explored in medicinal chemistry for its role as a building block in the synthesis of pharmaceuticals. Its structure suggests it may exhibit properties such as antimicrobial or antiviral activity, although specific biological effects would depend on further empirical studies. The compound is likely to be a solid or liquid at room temperature, with moderate solubility in organic solvents. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C7H7FN2O4
InChI:InChI=1/C7H7FN2O4/c1-14-5(11)3-10-2-4(8)6(12)9-7(10)13/h2H,3H2,1H3,(H,9,12,13)
SMILES:COC(=O)Cn1cc(c(nc1=O)O)F
Synonyms:- 1(2H)-pyrimidineacetic acid, 5-fluoro-3,4-dihydro-2,4-dioxo-, methyl ester
- Methyl (5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Fluorouracil-1-yl acetic acid methyl ester
CAS:5-Fluorouracil-1-yl acetic acid methyl ester is a PNA-related Derivative.Formula:C7H7FN2O4Color and Shape:SolidMolecular weight:202.14Ref: TM-TNU1052
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire
