CAS 56105-81-8
:(2R)-2-(3-benzoylphenyl)propanoic acid
Description:
(2R)-2-(3-benzoylphenyl)propanoic acid, commonly known as a non-steroidal anti-inflammatory drug (NSAID), exhibits several notable characteristics. It features a propanoic acid backbone with a chiral center at the second carbon, contributing to its specific stereochemistry. The presence of the benzoylphenyl group enhances its lipophilicity, which can influence its absorption and distribution in biological systems. This compound typically exhibits anti-inflammatory, analgesic, and antipyretic properties, making it useful in the treatment of various inflammatory conditions. Its mechanism of action generally involves the inhibition of cyclooxygenase enzymes, leading to a decrease in prostaglandin synthesis. The compound is usually administered in oral form and may have side effects related to gastrointestinal irritation or cardiovascular risks, common to many NSAIDs. Additionally, its solubility and stability can be affected by pH and temperature, which are important considerations in formulation and storage. Overall, (2R)-2-(3-benzoylphenyl)propanoic acid is a significant compound in pharmacology, particularly in pain management and inflammation control.
Formula:C16H14O3
InChI:InChI=1/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/t11-/m1/s1
SMILES:C[C@H](c1cccc(c1)C(=O)c1ccccc1)C(=O)O
Synonyms:- benzeneacetic acid, 3-benzoyl-alpha-methyl-, (alphaR)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-(-)-Ketoprofen
CAS:Controlled ProductApplications Anti-inflammatory; analgesic.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Ueno, K., et al.: J. Med. Chem., 19, 941 (1976), Liversidge, G.G., Anal. Profiles Drug Subs., 10, 443 (1981), Jamali, F., et al.: Clin. Pharmacokinet., 19, 197 (1990),Formula:C16H14O3Color and Shape:NeatMolecular weight:254.28(R)-(-)-Ketoprofen
CAS:COX1/2 inhibitor; nonsteroidal anti-inflammatory drug
Formula:C16H14O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:254.28 g/mol(R)-Ketoprofen
CAS:(R)-Ketoprofen is a non-steroidal anti-inflammatory drug (NSAID) that exhibits oral activity and analgesic properties. Unlike its counterpart, (R)-Ketoprofen does not significantly enhance the increase of inflammatory cytokines (such as Tumor Necrosis Factor (TNF) and Interleukin-1 (IL-1)) induced by LPS. However, it can inhibit the anti-inflammatory activity of (S)-Ketoprofen.Formula:C16H14O3Color and Shape:SolidMolecular weight:254.28




