CAS 56127-59-4

2,5-bis(iodomethyl)-1,4-dioxane

Description:

2,5-Bis(iodomethyl)-1,4-dioxane is a chemical compound characterized by its unique structure, which includes a dioxane ring with two iodomethyl substituents at the 2 and 5 positions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity due to the presence of iodine atoms, which can participate in various chemical reactions, including nucleophilic substitutions. The dioxane ring contributes to its stability and solubility in organic solvents. Additionally, 2,5-bis(iodomethyl)-1,4-dioxane may exhibit biological activity, making it of interest in medicinal chemistry and synthetic applications. However, handling this compound requires caution due to the potential toxicity associated with iodine and the reactivity of the iodomethyl groups. As with many halogenated compounds, it is important to consider environmental and safety regulations when working with this substance.

Formula: C₆H₁₀I₂O₂

InChI: InChI=1/C6H10I2O2/c7-1-5-3-10-6(2-8)4-9-5/h5-6H,1-4H2

SMILES: C(C1COC(CI)CO1)I

trans-2,5-Bis(iodomethyl)-1,4-dioxane

CAS: 56127-59-4

trans-2,5-Bis(iodomethyl)-1,4-dioxane

Purity: ≥95%

Molecular weight: 367.95g/mol

Ref: 54-OR310892